About N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine
N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine (PubChem CID 6976349) has the molecular formula C15H13NOS
and a molecular weight of 255.34 g/mol. Its IUPAC name is N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine |
| PubChem CID | 6976349 |
| Molecular Formula | C15H13NOS |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine |
| SMILES | ON=C1C[C@H](c2ccccc2)Sc2ccccc21 |
| InChI | InChI=1S/C15H13NOS/c17-16-13-10-15(11-6-2-1-3-7-11)18-14-9-5-4-8-12(13)14/h1-9,15,17H,10H2/t15-/m1/s1 |
| InChIKey | ZNBLSMMEPDCZRC-OAHLLOKOSA-N |
| XLogP | 4.10 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine?
The IUPAC name of N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine (CID 6976349) is N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine.
What is the SMILES notation for N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine?
The canonical SMILES for N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine is ON=C1C[C@H](c2ccccc2)Sc2ccccc21.
What is the InChIKey of N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine?
The InChIKey is ZNBLSMMEPDCZRC-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H13NOS/c17-16-13-10-15(11-6-2-1-3-7-11)18-14-9-5-4-8-12(13)14/h1-9,15,17H,10H2/t15-/m1/s1.
What are the key properties of N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine?
N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine has a molecular weight of 255.34 g/mol, XLogP of 4.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine is sourced from PubChem (CID 6976349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).