C15H13NOS — CID 6976349
N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine (PubChem CID 6976349) has the molecular formula C15H13NOS and a molecular weight of 255.34 g/mol. Its IUPAC name is N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine.
| Compound Name | N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 6976349 |
| Molecular Formula | C15H13NOS |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | N-[(2R)-2-phenyl-2,3-dihydrothiochromen-4-ylidene]hydroxylamine |
| SMILES | ON=C1C[C@H](c2ccccc2)Sc2ccccc21 |
| InChI | InChI=1S/C15H13NOS/c17-16-13-10-15(11-6-2-1-3-7-11)18-14-9-5-4-8-12(13)14/h1-9,15,17H,10H2/t15-/m1/s1 |
| InChIKey | ZNBLSMMEPDCZRC-OAHLLOKOSA-N |
| XLogP | 4.10 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|