C17H13ClN2O4S — CID 6976517
[[2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetyl]amino] 2-chlorobenzoate (PubChem CID 6976517) has the molecular formula C17H13ClN2O4S and a molecular weight of 376.82 g/mol. Its IUPAC name is [[2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetyl]amino] 2-chlorobenzoate.
| Compound Name | [[2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetyl]amino] 2-chlorobenzoate |
|---|---|
| PubChem CID | 6976517 |
| Molecular Formula | C17H13ClN2O4S |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | [[2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetyl]amino] 2-chlorobenzoate |
| SMILES | O=C(C[C@H]1Sc2ccccc2NC1=O)NOC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H13ClN2O4S/c18-11-6-2-1-5-10(11)17(23)24-20-15(21)9-14-16(22)19-12-7-3-4-8-13(12)25-14/h1-8,14H,9H2,(H,19,22)(H,20,21)/t14-/m1/s1 |
| InChIKey | UJLJXUQHLKNEOT-CQSZACIVSA-N |
| XLogP | 3.03 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|