About (5S)-3-(10H-phenothiazin-2-yl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol
(5S)-3-(10H-phenothiazin-2-yl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol (PubChem CID 6977658) has the molecular formula C16H12F3N3OS
and a molecular weight of 351.35 g/mol. Its IUPAC name is (5S)-3-(10H-phenothiazin-2-yl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol.
Molecular Properties
| Compound Name | (5S)-3-(10H-phenothiazin-2-yl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol |
| PubChem CID | 6977658 |
| Molecular Formula | C16H12F3N3OS |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (5S)-3-(10H-phenothiazin-2-yl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol |
| SMILES | O[C@]1(C(F)(F)F)CC(c2ccc3c(c2)Nc2ccccc2S3)=NN1 |
| InChI | InChI=1S/C16H12F3N3OS/c17-16(18,19)15(23)8-12(21-22-15)9-5-6-14-11(7-9)20-10-3-1-2-4-13(10)24-14/h1-7,20,22-23H,8H2/t15-/m0/s1 |
| InChIKey | GBISDJXOQUYGBI-HNNXBMFYSA-N |
| XLogP | 3.84 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5S)-3-(10H-phenothiazin-2-yl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3-(10H-phenothiazin-2-yl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol?
The IUPAC name of (5S)-3-(10H-phenothiazin-2-yl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol (CID 6977658) is (5S)-3-(10H-phenothiazin-2-yl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol.
What is the SMILES notation for (5S)-3-(10H-phenothiazin-2-yl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol?
The canonical SMILES for (5S)-3-(10H-phenothiazin-2-yl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol is O[C@]1(C(F)(F)F)CC(c2ccc3c(c2)Nc2ccccc2S3)=NN1.
What is the InChIKey of (5S)-3-(10H-phenothiazin-2-yl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol?
The InChIKey is GBISDJXOQUYGBI-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H12F3N3OS/c17-16(18,19)15(23)8-12(21-22-15)9-5-6-14-11(7-9)20-10-3-1-2-4-13(10)24-14/h1-7,20,22-23H,8H2/t15-/m0/s1.
What are the key properties of (5S)-3-(10H-phenothiazin-2-yl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol?
(5S)-3-(10H-phenothiazin-2-yl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol has a molecular weight of 351.35 g/mol, XLogP of 3.84, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3-(10H-phenothiazin-2-yl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol is sourced from PubChem (CID 6977658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).