About (2R)-1-(4-fluoro-3,5-dimethylphenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine
(2R)-1-(4-fluoro-3,5-dimethylphenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine (PubChem CID 6977766) has the molecular formula C18H19F2NO2S
and a molecular weight of 351.42 g/mol. Its IUPAC name is (2R)-1-(4-fluoro-3,5-dimethylphenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine.
Molecular Properties
| Compound Name | (2R)-1-(4-fluoro-3,5-dimethylphenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine |
| PubChem CID | 6977766 |
| Molecular Formula | C18H19F2NO2S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (2R)-1-(4-fluoro-3,5-dimethylphenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine |
| SMILES | Cc1cc(S(=O)(=O)N2CCC[C@@H]2c2ccc(F)cc2)cc(C)c1F |
| InChI | InChI=1S/C18H19F2NO2S/c1-12-10-16(11-13(2)18(12)20)24(22,23)21-9-3-4-17(21)14-5-7-15(19)8-6-14/h5-8,10-11,17H,3-4,9H2,1-2H3/t17-/m1/s1 |
| InChIKey | JFBNNBIUJWKGPM-QGZVFWFLSA-N |
| XLogP | 4.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-1-(4-fluoro-3,5-dimethylphenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(4-fluoro-3,5-dimethylphenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine?
The IUPAC name of (2R)-1-(4-fluoro-3,5-dimethylphenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine (CID 6977766) is (2R)-1-(4-fluoro-3,5-dimethylphenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine.
What is the SMILES notation for (2R)-1-(4-fluoro-3,5-dimethylphenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine?
The canonical SMILES for (2R)-1-(4-fluoro-3,5-dimethylphenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine is Cc1cc(S(=O)(=O)N2CCC[C@@H]2c2ccc(F)cc2)cc(C)c1F.
What is the InChIKey of (2R)-1-(4-fluoro-3,5-dimethylphenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine?
The InChIKey is JFBNNBIUJWKGPM-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H19F2NO2S/c1-12-10-16(11-13(2)18(12)20)24(22,23)21-9-3-4-17(21)14-5-7-15(19)8-6-14/h5-8,10-11,17H,3-4,9H2,1-2H3/t17-/m1/s1.
What are the key properties of (2R)-1-(4-fluoro-3,5-dimethylphenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine?
(2R)-1-(4-fluoro-3,5-dimethylphenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine has a molecular weight of 351.42 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(4-fluoro-3,5-dimethylphenyl)sulfonyl-2-(4-fluorophenyl)pyrrolidine is sourced from PubChem (CID 6977766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).