C13H15Cl2NO2S — CID 6980060
N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-2,5-dichlorobenzenesulfonamide (PubChem CID 6980060) has the molecular formula C13H15Cl2NO2S and a molecular weight of 320.24 g/mol. Its IUPAC name is N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-2,5-dichlorobenzenesulfonamide.
| Compound Name | N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-2,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 6980060 |
| Molecular Formula | C13H15Cl2NO2S |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-2,5-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1C[C@H]2CC[C@H]1C2)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H15Cl2NO2S/c14-10-3-4-11(15)13(7-10)19(17,18)16-12-6-8-1-2-9(12)5-8/h3-4,7-9,12,16H,1-2,5-6H2/t8-,9-,12+/m0/s1 |
| InChIKey | NHZWBGHCVRQSOL-HOTUBEGUSA-N |
| XLogP | 3.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |