C15H13N3O3S2 — CID 6980705
1-(thiophen-2-ylmethyl)-5-(thiophen-2-ylmethyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 6980705) has the molecular formula C15H13N3O3S2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-(thiophen-2-ylmethyl)-5-(thiophen-2-ylmethyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(thiophen-2-ylmethyl)-5-(thiophen-2-ylmethyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6980705 |
| Molecular Formula | C15H13N3O3S2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 1-(thiophen-2-ylmethyl)-5-(thiophen-2-ylmethyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(Cc2cccs2)C(=O)C1/C=N/Cc1cccs1 |
| InChI | InChI=1S/C15H13N3O3S2/c19-13-12(8-16-7-10-3-1-5-22-10)14(20)18(15(21)17-13)9-11-4-2-6-23-11/h1-6,8,12H,7,9H2,(H,17,19,21)/b16-8+ |
| InChIKey | GQDOAIYZWHLLHG-LZYBPNLTSA-N |
| XLogP | 2.28 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|