About 1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone
1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone (PubChem CID 698121) has the molecular formula C11H12N2OS
and a molecular weight of 220.30 g/mol. Its IUPAC name is 1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone |
| PubChem CID | 698121 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone |
| SMILES | CC(=O)c1sc2nc(C)cc(C)c2c1N |
| InChI | InChI=1S/C11H12N2OS/c1-5-4-6(2)13-11-8(5)9(12)10(15-11)7(3)14/h4H,12H2,1-3H3 |
| InChIKey | ZDAPLZCKWHZNPX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone?
The IUPAC name of 1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone (CID 698121) is 1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone.
What is the SMILES notation for 1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone?
The canonical SMILES for 1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone is CC(=O)c1sc2nc(C)cc(C)c2c1N.
What is the InChIKey of 1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone?
The InChIKey is ZDAPLZCKWHZNPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2OS/c1-5-4-6(2)13-11-8(5)9(12)10(15-11)7(3)14/h4H,12H2,1-3H3.
What are the key properties of 1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone?
1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone has a molecular weight of 220.30 g/mol, XLogP of 2.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)ethanone is sourced from PubChem (CID 698121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).