C20H25ClN3O+ — CID 6981814
[(2R)-3-[2-(2-chlorophenyl)benzimidazol-1-yl]-2-hydroxypropyl]-diethylazanium (PubChem CID 6981814) has the molecular formula C20H25ClN3O+ and a molecular weight of 358.89 g/mol. Its IUPAC name is [(2R)-3-[2-(2-chlorophenyl)benzimidazol-1-yl]-2-hydroxypropyl]-diethylazanium.
| Compound Name | [(2R)-3-[2-(2-chlorophenyl)benzimidazol-1-yl]-2-hydroxypropyl]-diethylazanium |
|---|---|
| PubChem CID | 6981814 |
| Molecular Formula | C20H25ClN3O+ |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | [(2R)-3-[2-(2-chlorophenyl)benzimidazol-1-yl]-2-hydroxypropyl]-diethylazanium |
| SMILES | CC[NH+](CC)C[C@H](O)Cn1c(-c2ccccc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C20H24ClN3O/c1-3-23(4-2)13-15(25)14-24-19-12-8-7-11-18(19)22-20(24)16-9-5-6-10-17(16)21/h5-12,15,25H,3-4,13-14H2,1-2H3/p+1/t15-/m0/s1 |
| InChIKey | ACNLGPOKXXZHIW-HNNXBMFYSA-O |
| XLogP | 2.64 |
| TPSA | 42.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |