C25H36N2O2+2 — CID 6982029
1-[(2,4-dimethoxyphenyl)methyl]-4-(4-phenylcyclohexyl)piperazine-1,4-diium (PubChem CID 6982029) has the molecular formula C25H36N2O2+2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-4-(4-phenylcyclohexyl)piperazine-1,4-diium.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-4-(4-phenylcyclohexyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 6982029 |
| Molecular Formula | C25H36N2O2+2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-4-(4-phenylcyclohexyl)piperazine-1,4-diium |
| SMILES | COc1ccc(C[NH+]2CC[NH+](C3CCC(c4ccccc4)CC3)CC2)c(OC)c1 |
| InChI | InChI=1S/C25H34N2O2/c1-28-24-13-10-22(25(18-24)29-2)19-26-14-16-27(17-15-26)23-11-8-21(9-12-23)20-6-4-3-5-7-20/h3-7,10,13,18,21,23H,8-9,11-12,14-17,19H2,1-2H3/p+2 |
| InChIKey | VRADBUYXNXWTNL-UHFFFAOYSA-P |
| XLogP | 1.71 |
| TPSA | 27.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |