C32H31NO5 — CID 6982144
benzyl (4S,7S)-4-(2,4-dimethoxyphenyl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 6982144) has the molecular formula C32H31NO5 and a molecular weight of 509.60 g/mol. Its IUPAC name is benzyl (4S,7S)-4-(2,4-dimethoxyphenyl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | benzyl (4S,7S)-4-(2,4-dimethoxyphenyl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 6982144 |
| Molecular Formula | C32H31NO5 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | benzyl (4S,7S)-4-(2,4-dimethoxyphenyl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@H]2C3=C(C[C@H](c4ccccc4)CC3=O)N=C(C)C2C(=O)OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C32H31NO5/c1-20-29(32(35)38-19-21-10-6-4-7-11-21)30(25-15-14-24(36-2)18-28(25)37-3)31-26(33-20)16-23(17-27(31)34)22-12-8-5-9-13-22/h4-15,18,23,29-30H,16-17,19H2,1-3H3/t23-,29?,30+/m0/s1 |
| InChIKey | NOXGMAANAIFCPY-IBPPEIRJSA-N |
| XLogP | 6.02 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |