C19H22BrF3N2O+2 — CID 6982624
4-bromo-2-[[4-[[2-(trifluoromethyl)phenyl]methyl]piperazine-1,4-diium-1-yl]methyl]phenol (PubChem CID 6982624) has the molecular formula C19H22BrF3N2O+2 and a molecular weight of 431.30 g/mol. Its IUPAC name is 4-bromo-2-[[4-[[2-(trifluoromethyl)phenyl]methyl]piperazine-1,4-diium-1-yl]methyl]phenol.
| Compound Name | 4-bromo-2-[[4-[[2-(trifluoromethyl)phenyl]methyl]piperazine-1,4-diium-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 6982624 |
| Molecular Formula | C19H22BrF3N2O+2 |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 4-bromo-2-[[4-[[2-(trifluoromethyl)phenyl]methyl]piperazine-1,4-diium-1-yl]methyl]phenol |
| SMILES | Oc1ccc(Br)cc1C[NH+]1CC[NH+](Cc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H20BrF3N2O/c20-16-5-6-18(26)15(11-16)13-25-9-7-24(8-10-25)12-14-3-1-2-4-17(14)19(21,22)23/h1-6,11,26H,7-10,12-13H2/p+2 |
| InChIKey | QQJDDMSRVPMFDK-UHFFFAOYSA-P |
| XLogP | 1.66 |
| TPSA | 29.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|