C20H21BrN3O+ — CID 6982708
1-(4-bromophenyl)-2-(7,8-dimethyl-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone (PubChem CID 6982708) has the molecular formula C20H21BrN3O+ and a molecular weight of 399.31 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(7,8-dimethyl-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone.
| Compound Name | 1-(4-bromophenyl)-2-(7,8-dimethyl-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone |
|---|---|
| PubChem CID | 6982708 |
| Molecular Formula | C20H21BrN3O+ |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 1-(4-bromophenyl)-2-(7,8-dimethyl-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone |
| SMILES | Cc1cc2c(cc1C)[n+]1c(n2CC(=O)c2ccc(Br)cc2)NCCC1 |
| InChI | InChI=1S/C20H20BrN3O/c1-13-10-17-18(11-14(13)2)24(20-22-8-3-9-23(17)20)12-19(25)15-4-6-16(21)7-5-15/h4-7,10-11H,3,8-9,12H2,1-2H3/p+1 |
| InChIKey | JHGVZPSTQMTZEV-UHFFFAOYSA-O |
| XLogP | 4.01 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|