C7H8N3O4S- — CID 6983950
(2S)-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]butanoate (PubChem CID 6983950) has the molecular formula C7H8N3O4S- and a molecular weight of 230.22 g/mol. Its IUPAC name is (2S)-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]butanoate.
| Compound Name | (2S)-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]butanoate |
|---|---|
| PubChem CID | 6983950 |
| Molecular Formula | C7H8N3O4S- |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | (2S)-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]butanoate |
| SMILES | CC[C@H](Sc1n[nH]c(=O)[nH]c1=O)C(=O)[O-] |
| InChI | InChI=1S/C7H9N3O4S/c1-2-3(6(12)13)15-5-4(11)8-7(14)10-9-5/h3H,2H2,1H3,(H,12,13)(H2,8,10,11,14)/p-1/t3-/m0/s1 |
| InChIKey | NSXPNTAFBWHZPH-VKHMYHEASA-M |
| XLogP | -1.92 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |