About (4R)-4-(2-fluorophenyl)-2-methyl-5-oxo-3,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile
(4R)-4-(2-fluorophenyl)-2-methyl-5-oxo-3,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile (PubChem CID 6983986) has the molecular formula C20H13FN2O
and a molecular weight of 316.33 g/mol. Its IUPAC name is (4R)-4-(2-fluorophenyl)-2-methyl-5-oxo-3,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | (4R)-4-(2-fluorophenyl)-2-methyl-5-oxo-3,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile |
| PubChem CID | 6983986 |
| Molecular Formula | C20H13FN2O |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (4R)-4-(2-fluorophenyl)-2-methyl-5-oxo-3,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile |
| SMILES | CC1=NC2=C(C(=O)c3ccccc32)[C@H](c2ccccc2F)C1C#N |
| InChI | InChI=1S/C20H13FN2O/c1-11-15(10-22)17(14-8-4-5-9-16(14)21)18-19(23-11)12-6-2-3-7-13(12)20(18)24/h2-9,15,17H,1H3/t15?,17-/m1/s1 |
| InChIKey | GHHZBFXAGZRPSG-OMOCHNIRSA-N |
| XLogP | 4.13 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-(2-fluorophenyl)-2-methyl-5-oxo-3,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(2-fluorophenyl)-2-methyl-5-oxo-3,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile?
The IUPAC name of (4R)-4-(2-fluorophenyl)-2-methyl-5-oxo-3,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile (CID 6983986) is (4R)-4-(2-fluorophenyl)-2-methyl-5-oxo-3,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile.
What is the SMILES notation for (4R)-4-(2-fluorophenyl)-2-methyl-5-oxo-3,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile?
The canonical SMILES for (4R)-4-(2-fluorophenyl)-2-methyl-5-oxo-3,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile is CC1=NC2=C(C(=O)c3ccccc32)[C@H](c2ccccc2F)C1C#N.
What is the InChIKey of (4R)-4-(2-fluorophenyl)-2-methyl-5-oxo-3,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile?
The InChIKey is GHHZBFXAGZRPSG-OMOCHNIRSA-N. The full InChI is InChI=1S/C20H13FN2O/c1-11-15(10-22)17(14-8-4-5-9-16(14)21)18-19(23-11)12-6-2-3-7-13(12)20(18)24/h2-9,15,17H,1H3/t15?,17-/m1/s1.
What are the key properties of (4R)-4-(2-fluorophenyl)-2-methyl-5-oxo-3,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile?
(4R)-4-(2-fluorophenyl)-2-methyl-5-oxo-3,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile has a molecular weight of 316.33 g/mol, XLogP of 4.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(2-fluorophenyl)-2-methyl-5-oxo-3,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile is sourced from PubChem (CID 6983986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).