About 2-butan-2-ylphenol
2-butan-2-ylphenol (PubChem CID 6984) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-butan-2-ylphenol.
Molecular Properties
| Compound Name | 2-butan-2-ylphenol |
| PubChem CID | 6984 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-butan-2-ylphenol |
| SMILES | CCC(C)c1ccccc1O |
| InChI | InChI=1S/C10H14O/c1-3-8(2)9-6-4-5-7-10(9)11/h4-8,11H,3H2,1-2H3 |
| InChIKey | NGFPWHGISWUQOI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-ylphenol?
The IUPAC name of 2-butan-2-ylphenol (CID 6984) is 2-butan-2-ylphenol.
What is the SMILES notation for 2-butan-2-ylphenol?
The canonical SMILES for 2-butan-2-ylphenol is CCC(C)c1ccccc1O.
What is the InChIKey of 2-butan-2-ylphenol?
The InChIKey is NGFPWHGISWUQOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-3-8(2)9-6-4-5-7-10(9)11/h4-8,11H,3H2,1-2H3.
What are the key properties of 2-butan-2-ylphenol?
2-butan-2-ylphenol has a molecular weight of 150.22 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-ylphenol is sourced from PubChem (CID 6984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).