C13H21N3O5 — CID 6984226
(5R)-1-tert-butyl-5-[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 6984226) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is (5R)-1-tert-butyl-5-[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5R)-1-tert-butyl-5-[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6984226 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (5R)-1-tert-butyl-5-[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC(CO)(CO)/N=C/[C@@H]1C(=O)NC(=O)N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C13H21N3O5/c1-12(2,3)16-10(20)8(9(19)15-11(16)21)5-14-13(4,6-17)7-18/h5,8,17-18H,6-7H2,1-4H3,(H,15,19,21)/b14-5+/t8-/m1/s1 |
| InChIKey | BBTVGWBLBWEZIM-VJYAUKRXSA-N |
| XLogP | -0.71 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|