C15H15N3 — CID 698490
2,4,9-trimethylbenzo[b][1,8]naphthyridin-5-amine (PubChem CID 698490) has the molecular formula C15H15N3 and a molecular weight of 237.31 g/mol. Its IUPAC name is 2,4,9-trimethylbenzo[b][1,8]naphthyridin-5-amine.
| Compound Name | 2,4,9-trimethylbenzo[b][1,8]naphthyridin-5-amine |
|---|---|
| PubChem CID | 698490 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2,4,9-trimethylbenzo[b][1,8]naphthyridin-5-amine |
| SMILES | Cc1cc(C)c2c(N)c3cccc(C)c3nc2n1 |
| InChI | InChI=1S/C15H15N3/c1-8-5-4-6-11-13(16)12-9(2)7-10(3)17-15(12)18-14(8)11/h4-7H,1-3H3,(H2,16,17,18) |
| InChIKey | WRUVTYDQVPMYDZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|