C9H16NO+ — CID 6984949
1,3,6,6-tetramethyl-1,2-dihydropyridin-1-ium-5-one (PubChem CID 6984949) has the molecular formula C9H16NO+ and a molecular weight of 154.23 g/mol. Its IUPAC name is 1,3,6,6-tetramethyl-1,2-dihydropyridin-1-ium-5-one.
| Compound Name | 1,3,6,6-tetramethyl-1,2-dihydropyridin-1-ium-5-one |
|---|---|
| PubChem CID | 6984949 |
| Molecular Formula | C9H16NO+ |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 1,3,6,6-tetramethyl-1,2-dihydropyridin-1-ium-5-one |
| SMILES | CC1=CC(=O)C(C)(C)[NH+](C)C1 |
| InChI | InChI=1S/C9H15NO/c1-7-5-8(11)9(2,3)10(4)6-7/h5H,6H2,1-4H3/p+1 |
| InChIKey | JSZLHYXQMHUWHR-UHFFFAOYSA-O |
| XLogP | -0.19 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |