C16H21ClN4O4+2 — CID 6985177
2-(2-chlorophenyl)-6,6-dimethyl-5,7-dinitro-1,3-diazoniatricyclo[3.3.1.13,7]decane (PubChem CID 6985177) has the molecular formula C16H21ClN4O4+2 and a molecular weight of 368.82 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-6,6-dimethyl-5,7-dinitro-1,3-diazoniatricyclo[3.3.1.13,7]decane.
| Compound Name | 2-(2-chlorophenyl)-6,6-dimethyl-5,7-dinitro-1,3-diazoniatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 6985177 |
| Molecular Formula | C16H21ClN4O4+2 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-(2-chlorophenyl)-6,6-dimethyl-5,7-dinitro-1,3-diazoniatricyclo[3.3.1.13,7]decane |
| SMILES | CC1(C)C2([N+](=O)[O-])C[NH+]3CC1([N+](=O)[O-])C[NH+](C2)C3c1ccccc1Cl |
| InChI | InChI=1S/C16H19ClN4O4/c1-14(2)15(20(22)23)7-18-9-16(14,21(24)25)10-19(8-15)13(18)11-5-3-4-6-12(11)17/h3-6,13H,7-10H2,1-2H3/p+2 |
| InChIKey | AYKKHIDHZMNXEN-UHFFFAOYSA-P |
| XLogP | -0.79 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|