C14H24N4O4+2 — CID 6985361
6,6-dimethyl-5,7-dinitrospiro[1,3-diazoniatricyclo[3.3.1.13,7]decane-2,1'-cyclopentane] (PubChem CID 6985361) has the molecular formula C14H24N4O4+2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 6,6-dimethyl-5,7-dinitrospiro[1,3-diazoniatricyclo[3.3.1.13,7]decane-2,1'-cyclopentane].
| Compound Name | 6,6-dimethyl-5,7-dinitrospiro[1,3-diazoniatricyclo[3.3.1.13,7]decane-2,1'-cyclopentane] |
|---|---|
| PubChem CID | 6985361 |
| Molecular Formula | C14H24N4O4+2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 6,6-dimethyl-5,7-dinitrospiro[1,3-diazoniatricyclo[3.3.1.13,7]decane-2,1'-cyclopentane] |
| SMILES | CC1(C)C2([N+](=O)[O-])C[NH+]3CC1([N+](=O)[O-])C[NH+](C2)C31CCCC1 |
| InChI | InChI=1S/C14H22N4O4/c1-11(2)12(17(19)20)7-15-9-13(11,18(21)22)10-16(8-12)14(15)5-3-4-6-14/h3-10H2,1-2H3/p+2 |
| InChIKey | OTOSKRCCTZNWFH-UHFFFAOYSA-P |
| XLogP | -1.88 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|