About 6-methoxy-1,4-dihydroquinoxaline-2,3-dione
6-methoxy-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 698550) has the molecular formula C9H8N2O3
and a molecular weight of 192.17 g/mol. Its IUPAC name is 6-methoxy-1,4-dihydroquinoxaline-2,3-dione.
Molecular Properties
| Compound Name | 6-methoxy-1,4-dihydroquinoxaline-2,3-dione |
| PubChem CID | 698550 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 6-methoxy-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | COc1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C9H8N2O3/c1-14-5-2-3-6-7(4-5)11-9(13)8(12)10-6/h2-4H,1H3,(H,10,12)(H,11,13) |
| InChIKey | CHTYMWBYHAIEOF-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-1,4-dihydroquinoxaline-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-1,4-dihydroquinoxaline-2,3-dione?
The IUPAC name of 6-methoxy-1,4-dihydroquinoxaline-2,3-dione (CID 698550) is 6-methoxy-1,4-dihydroquinoxaline-2,3-dione.
What is the SMILES notation for 6-methoxy-1,4-dihydroquinoxaline-2,3-dione?
The canonical SMILES for 6-methoxy-1,4-dihydroquinoxaline-2,3-dione is COc1ccc2[nH]c(=O)c(=O)[nH]c2c1.
What is the InChIKey of 6-methoxy-1,4-dihydroquinoxaline-2,3-dione?
The InChIKey is CHTYMWBYHAIEOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3/c1-14-5-2-3-6-7(4-5)11-9(13)8(12)10-6/h2-4H,1H3,(H,10,12)(H,11,13).
What are the key properties of 6-methoxy-1,4-dihydroquinoxaline-2,3-dione?
6-methoxy-1,4-dihydroquinoxaline-2,3-dione has a molecular weight of 192.17 g/mol, XLogP of 0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-1,4-dihydroquinoxaline-2,3-dione is sourced from PubChem (CID 698550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).