About 3-phenylmethoxy-1,2-benzothiazole 1,1-dioxide
3-phenylmethoxy-1,2-benzothiazole 1,1-dioxide (PubChem CID 698616) has the molecular formula C14H11NO3S
and a molecular weight of 273.31 g/mol. Its IUPAC name is 3-phenylmethoxy-1,2-benzothiazole 1,1-dioxide.
Molecular Properties
| Compound Name | 3-phenylmethoxy-1,2-benzothiazole 1,1-dioxide |
| PubChem CID | 698616 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 3-phenylmethoxy-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(OCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C14H11NO3S/c16-19(17)13-9-5-4-8-12(13)14(15-19)18-10-11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | LJJHEIQCQRVYIT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenylmethoxy-1,2-benzothiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylmethoxy-1,2-benzothiazole 1,1-dioxide?
The IUPAC name of 3-phenylmethoxy-1,2-benzothiazole 1,1-dioxide (CID 698616) is 3-phenylmethoxy-1,2-benzothiazole 1,1-dioxide.
What is the SMILES notation for 3-phenylmethoxy-1,2-benzothiazole 1,1-dioxide?
The canonical SMILES for 3-phenylmethoxy-1,2-benzothiazole 1,1-dioxide is O=S1(=O)N=C(OCc2ccccc2)c2ccccc21.
What is the InChIKey of 3-phenylmethoxy-1,2-benzothiazole 1,1-dioxide?
The InChIKey is LJJHEIQCQRVYIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO3S/c16-19(17)13-9-5-4-8-12(13)14(15-19)18-10-11-6-2-1-3-7-11/h1-9H,10H2.
What are the key properties of 3-phenylmethoxy-1,2-benzothiazole 1,1-dioxide?
3-phenylmethoxy-1,2-benzothiazole 1,1-dioxide has a molecular weight of 273.31 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylmethoxy-1,2-benzothiazole 1,1-dioxide is sourced from PubChem (CID 698616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).