About 7-(4-benzhydrylpiperazin-4-ium-1-yl)-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine
7-(4-benzhydrylpiperazin-4-ium-1-yl)-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine (PubChem CID 6986368) has the molecular formula C28H26N5S+
and a molecular weight of 464.62 g/mol. Its IUPAC name is 7-(4-benzhydrylpiperazin-4-ium-1-yl)-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine.
Molecular Properties
| Compound Name | 7-(4-benzhydrylpiperazin-4-ium-1-yl)-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine |
| PubChem CID | 6986368 |
| Molecular Formula | C28H26N5S+ |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 7-(4-benzhydrylpiperazin-4-ium-1-yl)-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine |
| SMILES | c1ccc(-c2nsc3c(N4CC[NH+](C(c5ccccc5)c5ccccc5)CC4)ncnc23)cc1 |
| InChI | InChI=1S/C28H25N5S/c1-4-10-21(11-5-1)24-25-27(34-31-24)28(30-20-29-25)33-18-16-32(17-19-33)26(22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-15,20,26H,16-19H2/p+1 |
| InChIKey | QGHWEVDJWKCICP-UHFFFAOYSA-O |
| XLogP | 4.25 |
| TPSA | 46.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(4-benzhydrylpiperazin-4-ium-1-yl)-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-benzhydrylpiperazin-4-ium-1-yl)-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine?
The IUPAC name of 7-(4-benzhydrylpiperazin-4-ium-1-yl)-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine (CID 6986368) is 7-(4-benzhydrylpiperazin-4-ium-1-yl)-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine.
What is the SMILES notation for 7-(4-benzhydrylpiperazin-4-ium-1-yl)-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine?
The canonical SMILES for 7-(4-benzhydrylpiperazin-4-ium-1-yl)-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine is c1ccc(-c2nsc3c(N4CC[NH+](C(c5ccccc5)c5ccccc5)CC4)ncnc23)cc1.
What is the InChIKey of 7-(4-benzhydrylpiperazin-4-ium-1-yl)-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine?
The InChIKey is QGHWEVDJWKCICP-UHFFFAOYSA-O. The full InChI is InChI=1S/C28H25N5S/c1-4-10-21(11-5-1)24-25-27(34-31-24)28(30-20-29-25)33-18-16-32(17-19-33)26(22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-15,20,26H,16-19H2/p+1.
What are the key properties of 7-(4-benzhydrylpiperazin-4-ium-1-yl)-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine?
7-(4-benzhydrylpiperazin-4-ium-1-yl)-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine has a molecular weight of 464.62 g/mol, XLogP of 4.25, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-benzhydrylpiperazin-4-ium-1-yl)-3-phenyl-[1,2]thiazolo[4,5-d]pyrimidine is sourced from PubChem (CID 6986368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).