C21H17NO3 — CID 6986585
[(13S,17R)-11,15-dioxa-16-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaen-16-yl]-phenylmethanone (PubChem CID 6986585) has the molecular formula C21H17NO3 and a molecular weight of 331.37 g/mol. Its IUPAC name is [(13S,17R)-11,15-dioxa-16-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaen-16-yl]-phenylmethanone.
| Compound Name | [(13S,17R)-11,15-dioxa-16-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaen-16-yl]-phenylmethanone |
|---|---|
| PubChem CID | 6986585 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [(13S,17R)-11,15-dioxa-16-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaen-16-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1OC[C@@H]2COc3ccc4ccccc4c3[C@@H]21 |
| InChI | InChI=1S/C21H17NO3/c23-21(15-7-2-1-3-8-15)22-20-16(13-25-22)12-24-18-11-10-14-6-4-5-9-17(14)19(18)20/h1-11,16,20H,12-13H2/t16-,20+/m0/s1 |
| InChIKey | DQUSUZKQVRQLKS-OXJNMPFZSA-N |
| XLogP | 3.98 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |