C10H13N3O3S — CID 6987692
(1R,2S,5R)-2-(3,4-dimethyl-5-sulfanylidene-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 6987692) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is (1R,2S,5R)-2-(3,4-dimethyl-5-sulfanylidene-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1R,2S,5R)-2-(3,4-dimethyl-5-sulfanylidene-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 6987692 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (1R,2S,5R)-2-(3,4-dimethyl-5-sulfanylidene-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | Cc1nn([C@H]2CC(=O)[C@@H]3OC[C@@H]2O3)c(=S)n1C |
| InChI | InChI=1S/C10H13N3O3S/c1-5-11-13(10(17)12(5)2)6-3-7(14)9-15-4-8(6)16-9/h6,8-9H,3-4H2,1-2H3/t6-,8-,9+/m0/s1 |
| InChIKey | AYYZZHSYJJJJME-CNUIFLNQSA-N |
| XLogP | 0.51 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|