C16H13N4O2- — CID 6987693
4-[2-[(2-methylphenyl)methyl]tetrazol-5-yl]benzoate (PubChem CID 6987693) has the molecular formula C16H13N4O2- and a molecular weight of 293.31 g/mol. Its IUPAC name is 4-[2-[(2-methylphenyl)methyl]tetrazol-5-yl]benzoate.
| Compound Name | 4-[2-[(2-methylphenyl)methyl]tetrazol-5-yl]benzoate |
|---|---|
| PubChem CID | 6987693 |
| Molecular Formula | C16H13N4O2- |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 4-[2-[(2-methylphenyl)methyl]tetrazol-5-yl]benzoate |
| SMILES | Cc1ccccc1Cn1nnc(-c2ccc(C(=O)[O-])cc2)n1 |
| InChI | InChI=1S/C16H14N4O2/c1-11-4-2-3-5-14(11)10-20-18-15(17-19-20)12-6-8-13(9-7-12)16(21)22/h2-9H,10H2,1H3,(H,21,22)/p-1 |
| InChIKey | BJXFMGZBTLQREZ-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 83.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |