C16H17N4O6- — CID 6987802
4-[4-[[2-(4-methyl-2-nitrophenoxy)acetyl]amino]pyrazol-1-yl]butanoate (PubChem CID 6987802) has the molecular formula C16H17N4O6- and a molecular weight of 361.33 g/mol. Its IUPAC name is 4-[4-[[2-(4-methyl-2-nitrophenoxy)acetyl]amino]pyrazol-1-yl]butanoate.
| Compound Name | 4-[4-[[2-(4-methyl-2-nitrophenoxy)acetyl]amino]pyrazol-1-yl]butanoate |
|---|---|
| PubChem CID | 6987802 |
| Molecular Formula | C16H17N4O6- |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 4-[4-[[2-(4-methyl-2-nitrophenoxy)acetyl]amino]pyrazol-1-yl]butanoate |
| SMILES | Cc1ccc(OCC(=O)Nc2cnn(CCCC(=O)[O-])c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H18N4O6/c1-11-4-5-14(13(7-11)20(24)25)26-10-15(21)18-12-8-17-19(9-12)6-2-3-16(22)23/h4-5,7-9H,2-3,6,10H2,1H3,(H,18,21)(H,22,23)/p-1 |
| InChIKey | COPSMCHWVCKPCM-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 139.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|