C19H22N2O4 — CID 698823
ethyl (4R)-6-amino-5-cyano-4-(2-methoxyphenyl)-2-propyl-4H-pyran-3-carboxylate (PubChem CID 698823) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is ethyl (4R)-6-amino-5-cyano-4-(2-methoxyphenyl)-2-propyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl (4R)-6-amino-5-cyano-4-(2-methoxyphenyl)-2-propyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 698823 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | ethyl (4R)-6-amino-5-cyano-4-(2-methoxyphenyl)-2-propyl-4H-pyran-3-carboxylate |
| SMILES | CCCC1=C(C(=O)OCC)[C@H](c2ccccc2OC)C(C#N)=C(N)O1 |
| InChI | InChI=1S/C19H22N2O4/c1-4-8-15-17(19(22)24-5-2)16(13(11-20)18(21)25-15)12-9-6-7-10-14(12)23-3/h6-7,9-10,16H,4-5,8,21H2,1-3H3/t16-/m1/s1 |
| InChIKey | WMHBSSALMXHBOA-MRXNPFEDSA-N |
| XLogP | 3.12 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |