C17H14NO4S2- — CID 6988670
3-[(5Z)-5-[[(2S)-2-methyl-2H-chromen-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate (PubChem CID 6988670) has the molecular formula C17H14NO4S2- and a molecular weight of 360.44 g/mol. Its IUPAC name is 3-[(5Z)-5-[[(2S)-2-methyl-2H-chromen-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | 3-[(5Z)-5-[[(2S)-2-methyl-2H-chromen-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 6988670 |
| Molecular Formula | C17H14NO4S2- |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 3-[(5Z)-5-[[(2S)-2-methyl-2H-chromen-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
| SMILES | C[C@@H]1Oc2ccccc2C=C1/C=C1\SC(=S)N(CCC(=O)[O-])C1=O |
| InChI | InChI=1S/C17H15NO4S2/c1-10-12(8-11-4-2-3-5-13(11)22-10)9-14-16(21)18(17(23)24-14)7-6-15(19)20/h2-5,8-10H,6-7H2,1H3,(H,19,20)/p-1/b14-9-/t10-/m0/s1 |
| InChIKey | OPJMPDNYXRIESN-ADVUTCEVSA-M |
| XLogP | 1.74 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|