C15H9NO3 — CID 698892
2-(2-hydroxyphenyl)iminoindene-1,3-dione (PubChem CID 698892) has the molecular formula C15H9NO3 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)iminoindene-1,3-dione.
| Compound Name | 2-(2-hydroxyphenyl)iminoindene-1,3-dione |
|---|---|
| PubChem CID | 698892 |
| Molecular Formula | C15H9NO3 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-(2-hydroxyphenyl)iminoindene-1,3-dione |
| SMILES | O=c1c(=Nc2ccccc2O)c(=O)c2ccccc12 |
| InChI | InChI=1S/C15H9NO3/c17-12-8-4-3-7-11(12)16-13-14(18)9-5-1-2-6-10(9)15(13)19/h1-8,17H |
| InChIKey | LEVUICRLFJDCDL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'} |
|---|