About (4-phenyl-1,3-thiazol-2-yl)methanol
(4-phenyl-1,3-thiazol-2-yl)methanol (PubChem CID 698895) has the molecular formula C10H9NOS
and a molecular weight of 191.25 g/mol. Its IUPAC name is (4-phenyl-1,3-thiazol-2-yl)methanol.
Molecular Properties
| Compound Name | (4-phenyl-1,3-thiazol-2-yl)methanol |
| PubChem CID | 698895 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | (4-phenyl-1,3-thiazol-2-yl)methanol |
| SMILES | OCc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C10H9NOS/c12-6-10-11-9(7-13-10)8-4-2-1-3-5-8/h1-5,7,12H,6H2 |
| InChIKey | TYUWZKSJURGPRJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-phenyl-1,3-thiazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenyl-1,3-thiazol-2-yl)methanol?
The IUPAC name of (4-phenyl-1,3-thiazol-2-yl)methanol (CID 698895) is (4-phenyl-1,3-thiazol-2-yl)methanol.
What is the SMILES notation for (4-phenyl-1,3-thiazol-2-yl)methanol?
The canonical SMILES for (4-phenyl-1,3-thiazol-2-yl)methanol is OCc1nc(-c2ccccc2)cs1.
What is the InChIKey of (4-phenyl-1,3-thiazol-2-yl)methanol?
The InChIKey is TYUWZKSJURGPRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOS/c12-6-10-11-9(7-13-10)8-4-2-1-3-5-8/h1-5,7,12H,6H2.
What are the key properties of (4-phenyl-1,3-thiazol-2-yl)methanol?
(4-phenyl-1,3-thiazol-2-yl)methanol has a molecular weight of 191.25 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenyl-1,3-thiazol-2-yl)methanol is sourced from PubChem (CID 698895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).