About 4-phenyl-3H-1,3-thiazol-2-one
4-phenyl-3H-1,3-thiazol-2-one (PubChem CID 698903) has the molecular formula C9H7NOS
and a molecular weight of 177.23 g/mol. Its IUPAC name is 4-phenyl-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-phenyl-3H-1,3-thiazol-2-one |
| PubChem CID | 698903 |
| Molecular Formula | C9H7NOS |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | 4-phenyl-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(-c2ccccc2)cs1 |
| InChI | InChI=1S/C9H7NOS/c11-9-10-8(6-12-9)7-4-2-1-3-5-7/h1-6H,(H,10,11) |
| InChIKey | UXIWLHNMLDJWMF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenyl-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-3H-1,3-thiazol-2-one?
The IUPAC name of 4-phenyl-3H-1,3-thiazol-2-one (CID 698903) is 4-phenyl-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-phenyl-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-phenyl-3H-1,3-thiazol-2-one is O=c1[nH]c(-c2ccccc2)cs1.
What is the InChIKey of 4-phenyl-3H-1,3-thiazol-2-one?
The InChIKey is UXIWLHNMLDJWMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NOS/c11-9-10-8(6-12-9)7-4-2-1-3-5-7/h1-6H,(H,10,11).
What are the key properties of 4-phenyl-3H-1,3-thiazol-2-one?
4-phenyl-3H-1,3-thiazol-2-one has a molecular weight of 177.23 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-3H-1,3-thiazol-2-one is sourced from PubChem (CID 698903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).