C24H33N2O7+ — CID 6989401
[(3R,4S)-5-hydroxy-2,2-dimethyl-4-morpholin-4-ium-4-yl-6-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-3,4-dihydrochromen-3-yl] acetate (PubChem CID 6989401) has the molecular formula C24H33N2O7+ and a molecular weight of 461.54 g/mol. Its IUPAC name is [(3R,4S)-5-hydroxy-2,2-dimethyl-4-morpholin-4-ium-4-yl-6-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-3,4-dihydrochromen-3-yl] acetate.
| Compound Name | [(3R,4S)-5-hydroxy-2,2-dimethyl-4-morpholin-4-ium-4-yl-6-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-3,4-dihydrochromen-3-yl] acetate |
|---|---|
| PubChem CID | 6989401 |
| Molecular Formula | C24H33N2O7+ |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | [(3R,4S)-5-hydroxy-2,2-dimethyl-4-morpholin-4-ium-4-yl-6-[(E)-3-morpholin-4-yl-3-oxoprop-1-enyl]-3,4-dihydrochromen-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]([NH+]2CCOCC2)c2c(ccc(/C=C/C(=O)N3CCOCC3)c2O)OC1(C)C |
| InChI | InChI=1S/C24H32N2O7/c1-16(27)32-23-21(26-10-14-31-15-11-26)20-18(33-24(23,2)3)6-4-17(22(20)29)5-7-19(28)25-8-12-30-13-9-25/h4-7,21,23,29H,8-15H2,1-3H3/p+1/b7-5+/t21-,23+/m0/s1 |
| InChIKey | HGDOEHXCRQGKOA-ZSTNYQKQSA-O |
| XLogP | 0.32 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|