About 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid
4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid (PubChem CID 698975) has the molecular formula C18H14N2O5
and a molecular weight of 338.32 g/mol. Its IUPAC name is 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid |
| PubChem CID | 698975 |
| Molecular Formula | C18H14N2O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H14N2O5/c21-15(19-9-11-5-7-12(8-6-11)18(24)25)10-20-16(22)13-3-1-2-4-14(13)17(20)23/h1-8H,9-10H2,(H,19,21)(H,24,25) |
| InChIKey | WKNKQRHFWFZUMM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid?
The IUPAC name of 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid (CID 698975) is 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid.
What is the SMILES notation for 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid?
The canonical SMILES for 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid is O=C(CN1C(=O)c2ccccc2C1=O)NCc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid?
The InChIKey is WKNKQRHFWFZUMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O5/c21-15(19-9-11-5-7-12(8-6-11)18(24)25)10-20-16(22)13-3-1-2-4-14(13)17(20)23/h1-8H,9-10H2,(H,19,21)(H,24,25).
What are the key properties of 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid?
4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid has a molecular weight of 338.32 g/mol, XLogP of 1.30, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid is sourced from PubChem (CID 698975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).