C12H16BrN2O2+ — CID 6989964
(6-bromo-2-oxo-1,3-benzoxazol-3-yl)methyl-diethylazanium (PubChem CID 6989964) has the molecular formula C12H16BrN2O2+ and a molecular weight of 300.18 g/mol. Its IUPAC name is (6-bromo-2-oxo-1,3-benzoxazol-3-yl)methyl-diethylazanium.
| Compound Name | (6-bromo-2-oxo-1,3-benzoxazol-3-yl)methyl-diethylazanium |
|---|---|
| PubChem CID | 6989964 |
| Molecular Formula | C12H16BrN2O2+ |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | (6-bromo-2-oxo-1,3-benzoxazol-3-yl)methyl-diethylazanium |
| SMILES | CC[NH+](CC)Cn1c(=O)oc2cc(Br)ccc21 |
| InChI | InChI=1S/C12H15BrN2O2/c1-3-14(4-2)8-15-10-6-5-9(13)7-11(10)17-12(15)16/h5-7H,3-4,8H2,1-2H3/p+1 |
| InChIKey | BPIHLCMGQGJUHA-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |