C14H15ClN2O4S — CID 6989973
N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-chloro-2-nitrobenzenesulfonamide (PubChem CID 6989973) has the molecular formula C14H15ClN2O4S and a molecular weight of 342.80 g/mol. Its IUPAC name is N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-chloro-2-nitrobenzenesulfonamide.
| Compound Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-chloro-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 6989973 |
| Molecular Formula | C14H15ClN2O4S |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-chloro-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1S(=O)(=O)NC[C@@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H15ClN2O4S/c15-12-3-4-14(13(7-12)17(18)19)22(20,21)16-8-11-6-9-1-2-10(11)5-9/h1-4,7,9-11,16H,5-6,8H2/t9-,10-,11-/m0/s1 |
| InChIKey | SWYQDWZKIYFLGR-DCAQKATOSA-N |
| XLogP | 2.74 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|