About (1R)-4-methyl-1-(5-methylfuran-2-yl)pent-2-yne-1,4-diol
(1R)-4-methyl-1-(5-methylfuran-2-yl)pent-2-yne-1,4-diol (PubChem CID 699020) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is (1R)-4-methyl-1-(5-methylfuran-2-yl)pent-2-yne-1,4-diol.
Molecular Properties
| Compound Name | (1R)-4-methyl-1-(5-methylfuran-2-yl)pent-2-yne-1,4-diol |
| PubChem CID | 699020 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (1R)-4-methyl-1-(5-methylfuran-2-yl)pent-2-yne-1,4-diol |
| SMILES | Cc1ccc([C@H](O)C#CC(C)(C)O)o1 |
| InChI | InChI=1S/C11H14O3/c1-8-4-5-10(14-8)9(12)6-7-11(2,3)13/h4-5,9,12-13H,1-3H3/t9-/m1/s1 |
| InChIKey | YSJQPPZIJRVGME-SECBINFHSA-N |
| XLogP | 1.40 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'furan_A(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (1R)-4-methyl-1-(5-methylfuran-2-yl)pent-2-yne-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-4-methyl-1-(5-methylfuran-2-yl)pent-2-yne-1,4-diol?
The IUPAC name of (1R)-4-methyl-1-(5-methylfuran-2-yl)pent-2-yne-1,4-diol (CID 699020) is (1R)-4-methyl-1-(5-methylfuran-2-yl)pent-2-yne-1,4-diol.
What is the SMILES notation for (1R)-4-methyl-1-(5-methylfuran-2-yl)pent-2-yne-1,4-diol?
The canonical SMILES for (1R)-4-methyl-1-(5-methylfuran-2-yl)pent-2-yne-1,4-diol is Cc1ccc([C@H](O)C#CC(C)(C)O)o1.
What is the InChIKey of (1R)-4-methyl-1-(5-methylfuran-2-yl)pent-2-yne-1,4-diol?
The InChIKey is YSJQPPZIJRVGME-SECBINFHSA-N. The full InChI is InChI=1S/C11H14O3/c1-8-4-5-10(14-8)9(12)6-7-11(2,3)13/h4-5,9,12-13H,1-3H3/t9-/m1/s1.
What are the key properties of (1R)-4-methyl-1-(5-methylfuran-2-yl)pent-2-yne-1,4-diol?
(1R)-4-methyl-1-(5-methylfuran-2-yl)pent-2-yne-1,4-diol has a molecular weight of 194.23 g/mol, XLogP of 1.40, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-4-methyl-1-(5-methylfuran-2-yl)pent-2-yne-1,4-diol is sourced from PubChem (CID 699020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).