C22H25Br2NO4 — CID 6990246
ethyl (4R)-4-(3,5-dibromo-2-hydroxyphenyl)-2-ethyl-7,7-dimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 6990246) has the molecular formula C22H25Br2NO4 and a molecular weight of 527.25 g/mol. Its IUPAC name is ethyl (4R)-4-(3,5-dibromo-2-hydroxyphenyl)-2-ethyl-7,7-dimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | ethyl (4R)-4-(3,5-dibromo-2-hydroxyphenyl)-2-ethyl-7,7-dimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 6990246 |
| Molecular Formula | C22H25Br2NO4 |
| Molecular Weight | 527.25 g/mol |
| Exact Mass | 525.02 |
| IUPAC Name | ethyl (4R)-4-(3,5-dibromo-2-hydroxyphenyl)-2-ethyl-7,7-dimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1C(CC)=NC2=C(C(=O)CC(C)(C)C2)[C@H]1c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C22H25Br2NO4/c1-5-14-19(21(28)29-6-2)17(12-7-11(23)8-13(24)20(12)27)18-15(25-14)9-22(3,4)10-16(18)26/h7-8,17,19,27H,5-6,9-10H2,1-4H3/t17-,19?/m1/s1 |
| InChIKey | KQPGQCJROYAWOA-DUSLRRAJSA-N |
| XLogP | 5.69 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.25 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |