About 1'-prop-2-ynylspiro[1,3-dioxolane-2,3'-indole]-2'-one
1'-prop-2-ynylspiro[1,3-dioxolane-2,3'-indole]-2'-one (PubChem CID 699047) has the molecular formula C13H11NO3
and a molecular weight of 229.23 g/mol. Its IUPAC name is 1'-prop-2-ynylspiro[1,3-dioxolane-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 1'-prop-2-ynylspiro[1,3-dioxolane-2,3'-indole]-2'-one |
| PubChem CID | 699047 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 1'-prop-2-ynylspiro[1,3-dioxolane-2,3'-indole]-2'-one |
| SMILES | C#CCN1C(=O)C2(OCCO2)c2ccccc21 |
| InChI | InChI=1S/C13H11NO3/c1-2-7-14-11-6-4-3-5-10(11)13(12(14)15)16-8-9-17-13/h1,3-6H,7-9H2 |
| InChIKey | ITHRMVSNVPHPCR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1'-prop-2-ynylspiro[1,3-dioxolane-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-prop-2-ynylspiro[1,3-dioxolane-2,3'-indole]-2'-one?
The IUPAC name of 1'-prop-2-ynylspiro[1,3-dioxolane-2,3'-indole]-2'-one (CID 699047) is 1'-prop-2-ynylspiro[1,3-dioxolane-2,3'-indole]-2'-one.
What is the SMILES notation for 1'-prop-2-ynylspiro[1,3-dioxolane-2,3'-indole]-2'-one?
The canonical SMILES for 1'-prop-2-ynylspiro[1,3-dioxolane-2,3'-indole]-2'-one is C#CCN1C(=O)C2(OCCO2)c2ccccc21.
What is the InChIKey of 1'-prop-2-ynylspiro[1,3-dioxolane-2,3'-indole]-2'-one?
The InChIKey is ITHRMVSNVPHPCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO3/c1-2-7-14-11-6-4-3-5-10(11)13(12(14)15)16-8-9-17-13/h1,3-6H,7-9H2.
What are the key properties of 1'-prop-2-ynylspiro[1,3-dioxolane-2,3'-indole]-2'-one?
1'-prop-2-ynylspiro[1,3-dioxolane-2,3'-indole]-2'-one has a molecular weight of 229.23 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-prop-2-ynylspiro[1,3-dioxolane-2,3'-indole]-2'-one is sourced from PubChem (CID 699047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).