About 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid
2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid (PubChem CID 69911974) has the molecular formula C23H23NO4S2
and a molecular weight of 441.60 g/mol. Its IUPAC name is 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid |
| PubChem CID | 69911974 |
| Molecular Formula | C23H23NO4S2 |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid |
| SMILES | C1CCS(=O)(=O)[C@@](C1)(CC(=O)O)C2=CC=C(S2)C3=CC=C(C=C3)C4=CC=C(C=C4)N |
| InChI | InChI=1S/C23H23NO4S2/c24-19-9-7-17(8-10-19)16-3-5-18(6-4-16)20-11-12-21(29-20)23(15-22(25)26)13-1-2-14-30(23,27)28/h3-12H,1-2,13-15,24H2,(H,25,26)/t23-/m0/s1 |
| InChIKey | VQDVXZKEMIBIAQ-QHCPKHFHSA-N |
| XLogP | 3.60 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | 705 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid?
The IUPAC name of 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid (CID 69911974) is 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid.
What is the SMILES notation for 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid?
The canonical SMILES for 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid is C1CCS(=O)(=O)[C@@](C1)(CC(=O)O)C2=CC=C(S2)C3=CC=C(C=C3)C4=CC=C(C=C4)N.
What is the InChIKey of 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid?
The InChIKey is VQDVXZKEMIBIAQ-QHCPKHFHSA-N. The full InChI is InChI=1S/C23H23NO4S2/c24-19-9-7-17(8-10-19)16-3-5-18(6-4-16)20-11-12-21(29-20)23(15-22(25)26)13-1-2-14-30(23,27)28/h3-12H,1-2,13-15,24H2,(H,25,26)/t23-/m0/s1.
What are the key properties of 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid?
2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid has a molecular weight of 441.60 g/mol, XLogP of 3.60, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid is sourced from PubChem (CID 69911974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).