C23H32N4O2S — CID 6991386
(5E)-5-[(4-methoxyphenyl)methylidene]-3-(piperidin-1-ylmethyl)-2-(piperidin-1-ylmethylimino)-1,3-thiazolidin-4-one (PubChem CID 6991386) has the molecular formula C23H32N4O2S and a molecular weight of 428.60 g/mol. Its IUPAC name is (5E)-5-[(4-methoxyphenyl)methylidene]-3-(piperidin-1-ylmethyl)-2-(piperidin-1-ylmethylimino)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(4-methoxyphenyl)methylidene]-3-(piperidin-1-ylmethyl)-2-(piperidin-1-ylmethylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6991386 |
| Molecular Formula | C23H32N4O2S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (5E)-5-[(4-methoxyphenyl)methylidene]-3-(piperidin-1-ylmethyl)-2-(piperidin-1-ylmethylimino)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=C2/SC(=NCN3CCCCC3)N(CN3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C23H32N4O2S/c1-29-20-10-8-19(9-11-20)16-21-22(28)27(18-26-14-6-3-7-15-26)23(30-21)24-17-25-12-4-2-5-13-25/h8-11,16H,2-7,12-15,17-18H2,1H3/b21-16+,24-23? |
| InChIKey | CKBWYBIZGZOUQM-YSKMNUJESA-N |
| XLogP | 3.85 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|