C21H26O4 — CID 6991727
(4R,5R)-2,2-dimethyl-4,5-bis(phenylmethoxymethyl)-1,3-dioxolane (PubChem CID 6991727) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is (4R,5R)-2,2-dimethyl-4,5-bis(phenylmethoxymethyl)-1,3-dioxolane.
| Compound Name | (4R,5R)-2,2-dimethyl-4,5-bis(phenylmethoxymethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 6991727 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (4R,5R)-2,2-dimethyl-4,5-bis(phenylmethoxymethyl)-1,3-dioxolane |
| SMILES | CC1(C)O[C@H](COCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C21H26O4/c1-21(2)24-19(15-22-13-17-9-5-3-6-10-17)20(25-21)16-23-14-18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | CZZOKIBEPTVWIX-WOJBJXKFSA-N |
| XLogP | 3.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |