C9H10F4N2O3 — CID 6991759
1-[(1S)-1-(2,2,3,3-tetrafluoropropoxy)ethyl]pyrimidine-2,4-dione (PubChem CID 6991759) has the molecular formula C9H10F4N2O3 and a molecular weight of 270.18 g/mol. Its IUPAC name is 1-[(1S)-1-(2,2,3,3-tetrafluoropropoxy)ethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1S)-1-(2,2,3,3-tetrafluoropropoxy)ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 6991759 |
| Molecular Formula | C9H10F4N2O3 |
| Molecular Weight | 270.18 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 1-[(1S)-1-(2,2,3,3-tetrafluoropropoxy)ethyl]pyrimidine-2,4-dione |
| SMILES | C[C@H](OCC(F)(F)C(F)F)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C9H10F4N2O3/c1-5(18-4-9(12,13)7(10)11)15-3-2-6(16)14-8(15)17/h2-3,5,7H,4H2,1H3,(H,14,16,17)/t5-/m0/s1 |
| InChIKey | UIFDPINHESUGRX-YFKPBYRVSA-N |
| XLogP | 0.97 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|