C15H16N2O6 — CID 699190
methyl 4-[(3R)-3-[(2-methoxy-2-oxoethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 699190) has the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. Its IUPAC name is methyl 4-[(3R)-3-[(2-methoxy-2-oxoethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[(3R)-3-[(2-methoxy-2-oxoethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 699190 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | methyl 4-[(3R)-3-[(2-methoxy-2-oxoethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)CN[C@@H]1CC(=O)N(c2ccc(C(=O)OC)cc2)C1=O |
| InChI | InChI=1S/C15H16N2O6/c1-22-13(19)8-16-11-7-12(18)17(14(11)20)10-5-3-9(4-6-10)15(21)23-2/h3-6,11,16H,7-8H2,1-2H3/t11-/m1/s1 |
| InChIKey | ISKUCXCCXDIVRI-LLVKDONJSA-N |
| XLogP | -0.13 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|