C18H14N2O2 — CID 6992142
(3E,6E)-3,6-dibenzylidenepiperazine-2,5-dione (PubChem CID 6992142) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is (3E,6E)-3,6-dibenzylidenepiperazine-2,5-dione.
| Compound Name | (3E,6E)-3,6-dibenzylidenepiperazine-2,5-dione |
|---|---|
| PubChem CID | 6992142 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (3E,6E)-3,6-dibenzylidenepiperazine-2,5-dione |
| SMILES | O=c1[nH]/c(=C/c2ccccc2)c(=O)[nH]/c1=C/c1ccccc1 |
| InChI | InChI=1S/C18H14N2O2/c21-17-15(11-13-7-3-1-4-8-13)19-18(22)16(20-17)12-14-9-5-2-6-10-14/h1-12H,(H,19,22)(H,20,21)/b15-11+,16-12+ |
| InChIKey | RFSUEJIDSYCCLL-JOBJLJCHSA-N |
| XLogP | 0.72 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |