C14H17N3O2 — CID 6992360
(3R,5R)-4-(4-methylcyclohexyl)-2,6-dioxopiperidine-3,5-dicarbonitrile (PubChem CID 6992360) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is (3R,5R)-4-(4-methylcyclohexyl)-2,6-dioxopiperidine-3,5-dicarbonitrile.
| Compound Name | (3R,5R)-4-(4-methylcyclohexyl)-2,6-dioxopiperidine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 6992360 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (3R,5R)-4-(4-methylcyclohexyl)-2,6-dioxopiperidine-3,5-dicarbonitrile |
| SMILES | CC1CCC(C2[C@H](C#N)C(=O)NC(=O)[C@H]2C#N)CC1 |
| InChI | InChI=1S/C14H17N3O2/c1-8-2-4-9(5-3-8)12-10(6-15)13(18)17-14(19)11(12)7-16/h8-12H,2-5H2,1H3,(H,17,18,19)/t8?,9?,10-,11-/m0/s1 |
| InChIKey | ZYEWEBLLTDVFKM-TVUZUIDESA-N |
| XLogP | 1.36 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|