About (3S,4S)-1,3,4-triphenylazetidin-2-one
(3S,4S)-1,3,4-triphenylazetidin-2-one (PubChem CID 6992936) has the molecular formula C21H17NO
and a molecular weight of 299.37 g/mol. Its IUPAC name is (3S,4S)-1,3,4-triphenylazetidin-2-one.
Molecular Properties
| Compound Name | (3S,4S)-1,3,4-triphenylazetidin-2-one |
| PubChem CID | 6992936 |
| Molecular Formula | C21H17NO |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (3S,4S)-1,3,4-triphenylazetidin-2-one |
| SMILES | O=C1[C@@H](c2ccccc2)[C@@H](c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C21H17NO/c23-21-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)22(21)18-14-8-3-9-15-18/h1-15,19-20H/t19-,20+/m0/s1 |
| InChIKey | IUQCUELHHDRDJI-VQTJNVASSA-N |
| XLogP | 4.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S,4S)-1,3,4-triphenylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-1,3,4-triphenylazetidin-2-one?
The IUPAC name of (3S,4S)-1,3,4-triphenylazetidin-2-one (CID 6992936) is (3S,4S)-1,3,4-triphenylazetidin-2-one.
What is the SMILES notation for (3S,4S)-1,3,4-triphenylazetidin-2-one?
The canonical SMILES for (3S,4S)-1,3,4-triphenylazetidin-2-one is O=C1[C@@H](c2ccccc2)[C@@H](c2ccccc2)N1c1ccccc1.
What is the InChIKey of (3S,4S)-1,3,4-triphenylazetidin-2-one?
The InChIKey is IUQCUELHHDRDJI-VQTJNVASSA-N. The full InChI is InChI=1S/C21H17NO/c23-21-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)22(21)18-14-8-3-9-15-18/h1-15,19-20H/t19-,20+/m0/s1.
What are the key properties of (3S,4S)-1,3,4-triphenylazetidin-2-one?
(3S,4S)-1,3,4-triphenylazetidin-2-one has a molecular weight of 299.37 g/mol, XLogP of 4.56, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-1,3,4-triphenylazetidin-2-one is sourced from PubChem (CID 6992936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).