About (3S)-1-tert-butyl-4,5-dioxopyrrolidine-3-carbonitrile
(3S)-1-tert-butyl-4,5-dioxopyrrolidine-3-carbonitrile (PubChem CID 6993010) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is (3S)-1-tert-butyl-4,5-dioxopyrrolidine-3-carbonitrile.
Molecular Properties
| Compound Name | (3S)-1-tert-butyl-4,5-dioxopyrrolidine-3-carbonitrile |
| PubChem CID | 6993010 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (3S)-1-tert-butyl-4,5-dioxopyrrolidine-3-carbonitrile |
| SMILES | CC(C)(C)N1C[C@@H](C#N)C(=O)C1=O |
| InChI | InChI=1S/C9H12N2O2/c1-9(2,3)11-5-6(4-10)7(12)8(11)13/h6H,5H2,1-3H3/t6-/m1/s1 |
| InChIKey | FBPKUDAVWWVKQI-ZCFIWIBFSA-N |
| XLogP | 0.34 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1-tert-butyl-4,5-dioxopyrrolidine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-tert-butyl-4,5-dioxopyrrolidine-3-carbonitrile?
The IUPAC name of (3S)-1-tert-butyl-4,5-dioxopyrrolidine-3-carbonitrile (CID 6993010) is (3S)-1-tert-butyl-4,5-dioxopyrrolidine-3-carbonitrile.
What is the SMILES notation for (3S)-1-tert-butyl-4,5-dioxopyrrolidine-3-carbonitrile?
The canonical SMILES for (3S)-1-tert-butyl-4,5-dioxopyrrolidine-3-carbonitrile is CC(C)(C)N1C[C@@H](C#N)C(=O)C1=O.
What is the InChIKey of (3S)-1-tert-butyl-4,5-dioxopyrrolidine-3-carbonitrile?
The InChIKey is FBPKUDAVWWVKQI-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-9(2,3)11-5-6(4-10)7(12)8(11)13/h6H,5H2,1-3H3/t6-/m1/s1.
What are the key properties of (3S)-1-tert-butyl-4,5-dioxopyrrolidine-3-carbonitrile?
(3S)-1-tert-butyl-4,5-dioxopyrrolidine-3-carbonitrile has a molecular weight of 180.21 g/mol, XLogP of 0.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-tert-butyl-4,5-dioxopyrrolidine-3-carbonitrile is sourced from PubChem (CID 6993010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).