C10H18N2O2S2 — CID 6993079
(3S,6S)-3,6-bis(2-methylsulfanylethyl)piperazine-2,5-dione (PubChem CID 6993079) has the molecular formula C10H18N2O2S2 and a molecular weight of 262.40 g/mol. Its IUPAC name is (3S,6S)-3,6-bis(2-methylsulfanylethyl)piperazine-2,5-dione.
| Compound Name | (3S,6S)-3,6-bis(2-methylsulfanylethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 6993079 |
| Molecular Formula | C10H18N2O2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (3S,6S)-3,6-bis(2-methylsulfanylethyl)piperazine-2,5-dione |
| SMILES | CSCC[C@@H]1NC(=O)[C@H](CCSC)NC1=O |
| InChI | InChI=1S/C10H18N2O2S2/c1-15-5-3-7-9(13)12-8(4-6-16-2)10(14)11-7/h7-8H,3-6H2,1-2H3,(H,11,14)(H,12,13)/t7-,8-/m0/s1 |
| InChIKey | VSOISORJHNBTCV-YUMQZZPRSA-N |
| XLogP | 0.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |