About diethyl (2R,3R)-2,3-dihydroxybutanedioate
diethyl (2R,3R)-2,3-dihydroxybutanedioate (PubChem CID 6993580) has the molecular formula C8H14O6
and a molecular weight of 206.19 g/mol. Its IUPAC name is diethyl (2R,3R)-2,3-dihydroxybutanedioate.
Molecular Properties
| Compound Name | diethyl (2R,3R)-2,3-dihydroxybutanedioate |
| PubChem CID | 6993580 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | diethyl (2R,3R)-2,3-dihydroxybutanedioate |
| SMILES | CCOC(=O)[C@H](O)[C@@H](O)C(=O)OCC |
| InChI | InChI=1S/C8H14O6/c1-3-13-7(11)5(9)6(10)8(12)14-4-2/h5-6,9-10H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | YSAVZVORKRDODB-PHDIDXHHSA-N |
| XLogP | -1.17 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze diethyl (2R,3R)-2,3-dihydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (2R,3R)-2,3-dihydroxybutanedioate?
The IUPAC name of diethyl (2R,3R)-2,3-dihydroxybutanedioate (CID 6993580) is diethyl (2R,3R)-2,3-dihydroxybutanedioate.
What is the SMILES notation for diethyl (2R,3R)-2,3-dihydroxybutanedioate?
The canonical SMILES for diethyl (2R,3R)-2,3-dihydroxybutanedioate is CCOC(=O)[C@H](O)[C@@H](O)C(=O)OCC.
What is the InChIKey of diethyl (2R,3R)-2,3-dihydroxybutanedioate?
The InChIKey is YSAVZVORKRDODB-PHDIDXHHSA-N. The full InChI is InChI=1S/C8H14O6/c1-3-13-7(11)5(9)6(10)8(12)14-4-2/h5-6,9-10H,3-4H2,1-2H3/t5-,6-/m1/s1.
What are the key properties of diethyl (2R,3R)-2,3-dihydroxybutanedioate?
diethyl (2R,3R)-2,3-dihydroxybutanedioate has a molecular weight of 206.19 g/mol, XLogP of -1.17, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (2R,3R)-2,3-dihydroxybutanedioate is sourced from PubChem (CID 6993580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).